C36H34N4O4Si — CID 165065216
(2R,3R,4S,5R)-2-[6-(2-phenylethyl)purin-9-yl]-5-(triphenylsilyloxymethyl)oxolane-3,4-diol (PubChem CID 165065216) has the molecular formula C36H34N4O4Si and a molecular weight of 614.78 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(2-phenylethyl)purin-9-yl]-5-(triphenylsilyloxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(2-phenylethyl)purin-9-yl]-5-(triphenylsilyloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 165065216 |
| Molecular Formula | C36H34N4O4Si |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(2-phenylethyl)purin-9-yl]-5-(triphenylsilyloxymethyl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1n1cnc2c(CCc3ccccc3)ncnc21 |
| InChI | InChI=1S/C36H34N4O4Si/c41-33-31(23-43-45(27-15-7-2-8-16-27,28-17-9-3-10-18-28)29-19-11-4-12-20-29)44-36(34(33)42)40-25-39-32-30(37-24-38-35(32)40)22-21-26-13-5-1-6-14-26/h1-20,24-25,31,33-34,36,41-42H,21-23H2/t31-,33-,34-,36-/m1/s1 |
| InChIKey | XWNJEONOUBILBJ-YDXJMRNDSA-N |
| XLogP | 2.91 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|