C35H36N4O4Si — CID 165065217
(2R,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[6-[(3-ethynylphenyl)methyl]purin-9-yl]oxolane-3,4-diol (PubChem CID 165065217) has the molecular formula C35H36N4O4Si and a molecular weight of 604.78 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[6-[(3-ethynylphenyl)methyl]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[6-[(3-ethynylphenyl)methyl]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 165065217 |
| Molecular Formula | C35H36N4O4Si |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | (2R,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[6-[(3-ethynylphenyl)methyl]purin-9-yl]oxolane-3,4-diol |
| SMILES | C#Cc1cccc(Cc2ncnc3c2ncn3[C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C35H36N4O4Si/c1-5-24-13-12-14-25(19-24)20-28-30-33(37-22-36-28)39(23-38-30)34-32(41)31(40)29(43-34)21-42-44(35(2,3)4,26-15-8-6-9-16-26)27-17-10-7-11-18-27/h1,6-19,22-23,29,31-32,34,40-41H,20-21H2,2-4H3/t29-,31-,32-,34-/m1/s1 |
| InChIKey | ZILOPXPOTDTRSK-UVBUXLLRSA-N |
| XLogP | 3.59 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|