C19H25N5O9P2 — CID 122207763
[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 122207763) has the molecular formula C19H25N5O9P2 and a molecular weight of 529.38 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 122207763 |
| Molecular Formula | C19H25N5O9P2 |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-phenylethylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(NCCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H25N5O9P2/c25-15-13(8-32-35(30,31)11-34(27,28)29)33-19(16(15)26)24-10-23-14-17(21-9-22-18(14)24)20-7-6-12-4-2-1-3-5-12/h1-5,9-10,13,15-16,19,25-26H,6-8,11H2,(H,30,31)(H,20,21,22)(H2,27,28,29)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | DHWHGNKVQJXBOW-NVQRDWNXSA-N |
| XLogP | 0.44 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|