C22H30N6O10P2 — CID 130206266
[[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-morpholin-4-ylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 130206266) has the molecular formula C22H30N6O10P2 and a molecular weight of 600.46 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-morpholin-4-ylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-morpholin-4-ylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 130206266 |
| Molecular Formula | C22H30N6O10P2 |
| Molecular Weight | 600.46 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-morpholin-4-ylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)nc(N4CCOCC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H30N6O10P2/c29-17-15(11-37-40(34,35)13-39(31,32)33)38-21(18(17)30)28-12-24-16-19(23-10-14-4-2-1-3-5-14)25-22(26-20(16)28)27-6-8-36-9-7-27/h1-5,12,15,17-18,21,29-30H,6-11,13H2,(H,34,35)(H,23,25,26)(H2,31,32,33)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | YCLALYWWMYTOOL-QTQZEZTPSA-N |
| XLogP | 0.23 |
| TPSA | 221.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.46 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|