C19H26N6O10P2 — CID 155444522
[[(2R,4S,5R)-5-[6-(benzylamino)-2-(methylamino)purin-9-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444522) has the molecular formula C19H26N6O10P2 and a molecular weight of 560.40 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-[6-(benzylamino)-2-(methylamino)purin-9-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,4S,5R)-5-[6-(benzylamino)-2-(methylamino)purin-9-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444522 |
| Molecular Formula | C19H26N6O10P2 |
| Molecular Weight | 560.40 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | [[(2R,4S,5R)-5-[6-(benzylamino)-2-(methylamino)purin-9-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CNc1nc(NCc2ccccc2)c2ncn([C@@H]3O[C@H](COP(=O)(O)CP(=O)(O)O)C(O)(O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C19H26N6O10P2/c1-20-18-23-15(21-7-11-5-3-2-4-6-11)13-16(24-18)25(9-22-13)17-14(26)19(27,28)12(35-17)8-34-37(32,33)10-36(29,30)31/h2-6,9,12,14,17,26-28H,7-8,10H2,1H3,(H,32,33)(H2,29,30,31)(H2,20,21,23,24)/t12-,14+,17-/m1/s1 |
| InChIKey | RBQOIDYPKMUKTF-HACGYAERSA-N |
| XLogP | -0.24 |
| TPSA | 241.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.40 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|