C19H24ClN5O9P2 — CID 130205854
[1-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 130205854) has the molecular formula C19H24ClN5O9P2 and a molecular weight of 563.83 g/mol. Its IUPAC name is [1-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [1-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 130205854 |
| Molecular Formula | C19H24ClN5O9P2 |
| Molecular Weight | 563.83 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | [1-[(2S,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CC(OP(=O)(O)CP(=O)(O)O)[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H24ClN5O9P2/c1-10(34-36(31,32)9-35(28,29)30)15-13(26)14(27)18(33-15)25-8-22-12-16(23-19(20)24-17(12)25)21-7-11-5-3-2-4-6-11/h2-6,8,10,13-15,18,26-27H,7,9H2,1H3,(H,31,32)(H,21,23,24)(H2,28,29,30)/t10?,13-,14+,15+,18+/m0/s1 |
| InChIKey | BTLNXSRRIQGJON-VIAWXERISA-N |
| XLogP | 1.44 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.83 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|