C24H27N5O10P2 — CID 155444337
[hydroxy-[[(2R,4S,5R)-3,3,4-trihydroxy-5-[6-[(4-phenylphenyl)methylamino]purin-9-yl]oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid (PubChem CID 155444337) has the molecular formula C24H27N5O10P2 and a molecular weight of 607.45 g/mol. Its IUPAC name is [hydroxy-[[(2R,4S,5R)-3,3,4-trihydroxy-5-[6-[(4-phenylphenyl)methylamino]purin-9-yl]oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid.
| Compound Name | [hydroxy-[[(2R,4S,5R)-3,3,4-trihydroxy-5-[6-[(4-phenylphenyl)methylamino]purin-9-yl]oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444337 |
| Molecular Formula | C24H27N5O10P2 |
| Molecular Weight | 607.45 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | [hydroxy-[[(2R,4S,5R)-3,3,4-trihydroxy-5-[6-[(4-phenylphenyl)methylamino]purin-9-yl]oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(-c5ccccc5)cc4)ncnc32)[C@H](O)C1(O)O |
| InChI | InChI=1S/C24H27N5O10P2/c30-20-23(39-18(24(20,31)32)11-38-41(36,37)14-40(33,34)35)29-13-28-19-21(26-12-27-22(19)29)25-10-15-6-8-17(9-7-15)16-4-2-1-3-5-16/h1-9,12-13,18,20,23,30-32H,10-11,14H2,(H,36,37)(H,25,26,27)(H2,33,34,35)/t18-,20+,23-/m1/s1 |
| InChIKey | IHFHSSUSUBMITI-QMHWCDLVSA-N |
| XLogP | 1.38 |
| TPSA | 229.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|