C20H21ClN4O4 — CID 25260175
9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloropurine (PubChem CID 25260175) has the molecular formula C20H21ClN4O4 and a molecular weight of 416.87 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloropurine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloropurine |
|---|---|
| PubChem CID | 25260175 |
| Molecular Formula | C20H21ClN4O4 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-chloropurine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COCc1ccccc1)O[C@H]2n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C20H21ClN4O4/c1-20(2)28-15-13(9-26-8-12-6-4-3-5-7-12)27-19(16(15)29-20)25-11-24-14-17(21)22-10-23-18(14)25/h3-7,10-11,13,15-16,19H,8-9H2,1-2H3/t13-,15-,16-,19-/m1/s1 |
| InChIKey | KHGIWVAMTNGUOA-NVQRDWNXSA-N |
| XLogP | 3.11 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |