C34H34FN5O4 — CID 155138688
9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(4-phenylphenyl)methoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(3-fluorophenyl)methyl]-N-methylpurin-6-amine (PubChem CID 155138688) has the molecular formula C34H34FN5O4 and a molecular weight of 595.68 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(4-phenylphenyl)methoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(3-fluorophenyl)methyl]-N-methylpurin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(4-phenylphenyl)methoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(3-fluorophenyl)methyl]-N-methylpurin-6-amine |
|---|---|
| PubChem CID | 155138688 |
| Molecular Formula | C34H34FN5O4 |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(4-phenylphenyl)methoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[(3-fluorophenyl)methyl]-N-methylpurin-6-amine |
| SMILES | CN(Cc1cccc(F)c1)c1ncnc2c1ncn2[C@@H]1O[C@H](COCc2ccc(-c3ccccc3)cc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C34H34FN5O4/c1-34(2)43-29-27(19-41-18-22-12-14-25(15-13-22)24-9-5-4-6-10-24)42-33(30(29)44-34)40-21-38-28-31(36-20-37-32(28)40)39(3)17-23-8-7-11-26(35)16-23/h4-16,20-21,27,29-30,33H,17-19H2,1-3H3/t27-,29-,30-,33-/m1/s1 |
| InChIKey | QWHFIDXPSWLNKQ-JHZZHVAFSA-N |
| XLogP | 5.90 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |