C26H26FN7O4 — CID 155138470
(2R,3R,4S,5R)-2-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]-5-(1H-pyrrolo[2,3-b]pyridin-5-ylmethoxymethyl)oxolane-3,4-diol (PubChem CID 155138470) has the molecular formula C26H26FN7O4 and a molecular weight of 519.54 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]-5-(1H-pyrrolo[2,3-b]pyridin-5-ylmethoxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]-5-(1H-pyrrolo[2,3-b]pyridin-5-ylmethoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 155138470 |
| Molecular Formula | C26H26FN7O4 |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]-5-(1H-pyrrolo[2,3-b]pyridin-5-ylmethoxymethyl)oxolane-3,4-diol |
| SMILES | CN(Cc1cccc(F)c1)c1ncnc2c1ncn2[C@@H]1O[C@H](COCc2cnc3[nH]ccc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H26FN7O4/c1-33(10-15-3-2-4-18(27)8-15)24-20-25(31-13-30-24)34(14-32-20)26-22(36)21(35)19(38-26)12-37-11-16-7-17-5-6-28-23(17)29-9-16/h2-9,13-14,19,21-22,26,35-36H,10-12H2,1H3,(H,28,29)/t19-,21-,22-,26-/m1/s1 |
| InChIKey | KELRCDLTARYIRP-RKCWLVDCSA-N |
| XLogP | 2.31 |
| TPSA | 134.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |