C24H24FN7O2S — CID 155138941
O-[[(2S)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolan-2-yl]methyl] N-pyridin-3-ylcarbamothioate (PubChem CID 155138941) has the molecular formula C24H24FN7O2S and a molecular weight of 493.57 g/mol. Its IUPAC name is O-[[(2S)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolan-2-yl]methyl] N-pyridin-3-ylcarbamothioate.
| Compound Name | O-[[(2S)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolan-2-yl]methyl] N-pyridin-3-ylcarbamothioate |
|---|---|
| PubChem CID | 155138941 |
| Molecular Formula | C24H24FN7O2S |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | O-[[(2S)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolan-2-yl]methyl] N-pyridin-3-ylcarbamothioate |
| SMILES | CN(Cc1cccc(F)c1)c1ncnc2c1ncn2C1CC[C@@H](COC(=S)Nc2cccnc2)O1 |
| InChI | InChI=1S/C24H24FN7O2S/c1-31(12-16-4-2-5-17(25)10-16)22-21-23(28-14-27-22)32(15-29-21)20-8-7-19(34-20)13-33-24(35)30-18-6-3-9-26-11-18/h2-6,9-11,14-15,19-20H,7-8,12-13H2,1H3,(H,30,35)/t19-,20?/m0/s1 |
| InChIKey | UZBSZLSTMLFKRH-XJDOXCRVSA-N |
| XLogP | 4.09 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|