C26H25FN6O4S — CID 155138972
O-[[(2S)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolan-2-yl]methyl] N-(1,3-benzodioxol-5-yl)carbamothioate (PubChem CID 155138972) has the molecular formula C26H25FN6O4S and a molecular weight of 536.59 g/mol. Its IUPAC name is O-[[(2S)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolan-2-yl]methyl] N-(1,3-benzodioxol-5-yl)carbamothioate.
| Compound Name | O-[[(2S)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolan-2-yl]methyl] N-(1,3-benzodioxol-5-yl)carbamothioate |
|---|---|
| PubChem CID | 155138972 |
| Molecular Formula | C26H25FN6O4S |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | O-[[(2S)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolan-2-yl]methyl] N-(1,3-benzodioxol-5-yl)carbamothioate |
| SMILES | CN(Cc1cccc(F)c1)c1ncnc2c1ncn2C1CC[C@@H](COC(=S)Nc2ccc3c(c2)OCO3)O1 |
| InChI | InChI=1S/C26H25FN6O4S/c1-32(11-16-3-2-4-17(27)9-16)24-23-25(29-13-28-24)33(14-30-23)22-8-6-19(37-22)12-34-26(38)31-18-5-7-20-21(10-18)36-15-35-20/h2-5,7,9-10,13-14,19,22H,6,8,11-12,15H2,1H3,(H,31,38)/t19-,22?/m0/s1 |
| InChIKey | VWPQYCVXNBBPTK-YDNXMHBPSA-N |
| XLogP | 4.42 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|