C36H33FN6O3 — CID 155128321
(2R,3S,4R,5R)-2-(2,2-diphenyl-2-pyridin-4-ylethyl)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolane-3,4-diol (PubChem CID 155128321) has the molecular formula C36H33FN6O3 and a molecular weight of 616.70 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(2,2-diphenyl-2-pyridin-4-ylethyl)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(2,2-diphenyl-2-pyridin-4-ylethyl)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 155128321 |
| Molecular Formula | C36H33FN6O3 |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | (2R,3S,4R,5R)-2-(2,2-diphenyl-2-pyridin-4-ylethyl)-5-[6-[(3-fluorophenyl)methyl-methylamino]purin-9-yl]oxolane-3,4-diol |
| SMILES | CN(Cc1cccc(F)c1)c1ncnc2c1ncn2[C@@H]1O[C@H](CC(c2ccccc2)(c2ccccc2)c2ccncc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C36H33FN6O3/c1-42(21-24-9-8-14-28(37)19-24)33-30-34(40-22-39-33)43(23-41-30)35-32(45)31(44)29(46-35)20-36(25-10-4-2-5-11-25,26-12-6-3-7-13-26)27-15-17-38-18-16-27/h2-19,22-23,29,31-32,35,44-45H,20-21H2,1H3/t29-,31-,32-,35-/m1/s1 |
| InChIKey | QNBVJDYMTLOLHW-QSYCCZFCSA-N |
| XLogP | 5.04 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |