C29H33FN6O5 — CID 166943945
[(3aR,4R,6R,6aR)-4-[6-[(3-fluorocyclohepta-1,3,6-trien-1-yl)methyl-methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-anilinomethanol (PubChem CID 166943945) has the molecular formula C29H33FN6O5 and a molecular weight of 564.62 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-[6-[(3-fluorocyclohepta-1,3,6-trien-1-yl)methyl-methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-anilinomethanol.
| Compound Name | [(3aR,4R,6R,6aR)-4-[6-[(3-fluorocyclohepta-1,3,6-trien-1-yl)methyl-methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-anilinomethanol |
|---|---|
| PubChem CID | 166943945 |
| Molecular Formula | C29H33FN6O5 |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-[6-[(3-fluorocyclohepta-1,3,6-trien-1-yl)methyl-methylamino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-anilinomethanol |
| SMILES | CN(CC1=CC(F)=CCC=C1)c1ncnc2c1ncn2[C@@H]1O[C@H](COC(O)Nc2ccccc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C29H33FN6O5/c1-29(2)40-23-21(15-38-28(37)34-20-11-5-4-6-12-20)39-27(24(23)41-29)36-17-33-22-25(31-16-32-26(22)36)35(3)14-18-9-7-8-10-19(30)13-18/h4-7,9-13,16-17,21,23-24,27-28,34,37H,8,14-15H2,1-3H3/t21-,23-,24-,27-,28?/m1/s1 |
| InChIKey | RSAKESKORRYJOQ-YVNNPSHVSA-N |
| XLogP | 3.82 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|