C27H26N6O7 — CID 11341793
2-[[2,2-dimethyl-4-[6-(phenylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]benzoic acid (PubChem CID 11341793) has the molecular formula C27H26N6O7 and a molecular weight of 546.54 g/mol. Its IUPAC name is 2-[[2,2-dimethyl-4-[6-(phenylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]benzoic acid.
| Compound Name | 2-[[2,2-dimethyl-4-[6-(phenylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 11341793 |
| Molecular Formula | C27H26N6O7 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 2-[[2,2-dimethyl-4-[6-(phenylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]benzoic acid |
| SMILES | CC1(C)OC2C(COc3ccccc3C(=O)O)OC(n3cnc4c(NC(=O)Nc5ccccc5)ncnc43)C2O1 |
| InChI | InChI=1S/C27H26N6O7/c1-27(2)39-20-18(12-37-17-11-7-6-10-16(17)25(34)35)38-24(21(20)40-27)33-14-30-19-22(28-13-29-23(19)33)32-26(36)31-15-8-4-3-5-9-15/h3-11,13-14,18,20-21,24H,12H2,1-2H3,(H,34,35)(H2,28,29,31,32,36) |
| InChIKey | ZWXUGFKQSXTCHP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |