C32H38InN7O7 — CID 154104965
2-[[2-(heptylindiganylmethyl)-4-[6-(phenylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid (PubChem CID 154104965) has the molecular formula C32H38InN7O7 and a molecular weight of 747.52 g/mol. Its IUPAC name is 2-[[2-(heptylindiganylmethyl)-4-[6-(phenylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid.
| Compound Name | 2-[[2-(heptylindiganylmethyl)-4-[6-(phenylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 154104965 |
| Molecular Formula | C32H38InN7O7 |
| Molecular Weight | 747.52 g/mol |
| Exact Mass | 747.19 |
| IUPAC Name | 2-[[2-(heptylindiganylmethyl)-4-[6-(phenylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid |
| SMILES | CCCCCCC[InH]CC1OC2C(COc3ncccc3C(=O)O)OC(n3cnc4c(NC(=O)Nc5ccccc5)ncnc43)C2O1 |
| InChI | InChI=1S/C25H22N7O7.C7H15.In.H/c1-13-37-18-16(10-36-22-15(24(33)34)8-5-9-26-22)39-23(19(18)38-13)32-12-29-17-20(27-11-28-21(17)32)31-25(35)30-14-6-3-2-4-7-14;1-3-5-7-6-4-2;;/h2-9,11-13,16,18-19,23H,1,10H2,(H,33,34)(H2,27,28,30,31,35);1,3-7H2,2H3;; |
| InChIKey | ZRSJMAOKSRJOHT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 171.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|