C27H28N8O7S — CID 11169419
1-[9-[2-benzyl-6-[(methylsulfonylcarbamoylamino)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-phenylurea (PubChem CID 11169419) has the molecular formula C27H28N8O7S and a molecular weight of 608.64 g/mol. Its IUPAC name is 1-[9-[2-benzyl-6-[(methylsulfonylcarbamoylamino)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-phenylurea.
| Compound Name | 1-[9-[2-benzyl-6-[(methylsulfonylcarbamoylamino)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-phenylurea |
|---|---|
| PubChem CID | 11169419 |
| Molecular Formula | C27H28N8O7S |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | 1-[9-[2-benzyl-6-[(methylsulfonylcarbamoylamino)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-phenylurea |
| SMILES | CS(=O)(=O)NC(=O)NCC1OC(n2cnc3c(NC(=O)Nc4ccccc4)ncnc32)C2OC(Cc3ccccc3)OC12 |
| InChI | InChI=1S/C27H28N8O7S/c1-43(38,39)34-26(36)28-13-18-21-22(42-19(41-21)12-16-8-4-2-5-9-16)25(40-18)35-15-31-20-23(29-14-30-24(20)35)33-27(37)32-17-10-6-3-7-11-17/h2-11,14-15,18-19,21-22,25H,12-13H2,1H3,(H2,28,34,36)(H2,29,30,32,33,37) |
| InChIKey | MOHHAVNREZOMSJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |