C22H26N8O5 — CID 70880623
1-[9-[(4R,6R)-2,2-dimethyl-6-[(methylcarbamoylamino)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-phenylurea (PubChem CID 70880623) has the molecular formula C22H26N8O5 and a molecular weight of 482.50 g/mol. Its IUPAC name is 1-[9-[(4R,6R)-2,2-dimethyl-6-[(methylcarbamoylamino)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-phenylurea.
| Compound Name | 1-[9-[(4R,6R)-2,2-dimethyl-6-[(methylcarbamoylamino)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-phenylurea |
|---|---|
| PubChem CID | 70880623 |
| Molecular Formula | C22H26N8O5 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 1-[9-[(4R,6R)-2,2-dimethyl-6-[(methylcarbamoylamino)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-phenylurea |
| SMILES | CNC(=O)NC[C@H]1O[C@@H](n2cnc3c(NC(=O)Nc4ccccc4)ncnc32)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C22H26N8O5/c1-22(2)34-15-13(9-24-20(31)23-3)33-19(16(15)35-22)30-11-27-14-17(25-10-26-18(14)30)29-21(32)28-12-7-5-4-6-8-12/h4-8,10-11,13,15-16,19H,9H2,1-3H3,(H2,23,24,31)(H2,25,26,28,29,32)/t13-,15?,16?,19-/m1/s1 |
| InChIKey | HMWGCNUDNQHGBX-BECUHMJXSA-N |
| XLogP | 1.82 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |