C31H50N8O5Si2 — CID 123755856
1-[9-[(2R,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(methylcarbamoylamino)methyl]oxolan-2-yl]purin-6-yl]-3-phenylurea (PubChem CID 123755856) has the molecular formula C31H50N8O5Si2 and a molecular weight of 670.96 g/mol. Its IUPAC name is 1-[9-[(2R,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(methylcarbamoylamino)methyl]oxolan-2-yl]purin-6-yl]-3-phenylurea.
| Compound Name | 1-[9-[(2R,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(methylcarbamoylamino)methyl]oxolan-2-yl]purin-6-yl]-3-phenylurea |
|---|---|
| PubChem CID | 123755856 |
| Molecular Formula | C31H50N8O5Si2 |
| Molecular Weight | 670.96 g/mol |
| Exact Mass | 670.34 |
| IUPAC Name | 1-[9-[(2R,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(methylcarbamoylamino)methyl]oxolan-2-yl]purin-6-yl]-3-phenylurea |
| SMILES | CNC(=O)NC[C@H]1O[C@@H](n2cnc3c(NC(=O)Nc4ccccc4)ncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H50N8O5Si2/c1-30(2,3)45(8,9)43-23-21(17-33-28(40)32-7)42-27(24(23)44-46(10,11)31(4,5)6)39-19-36-22-25(34-18-35-26(22)39)38-29(41)37-20-15-13-12-14-16-20/h12-16,18-19,21,23-24,27H,17H2,1-11H3,(H2,32,33,40)(H2,34,35,37,38,41)/t21-,23+,24-,27-/m1/s1 |
| InChIKey | QRNGTFCYIZAZOC-IFZRMHHFSA-N |
| XLogP | 6.08 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.96 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|