C19H21N7O5 — CID 143324447
2-[[5-[6-(ethylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy]pyridine-3-carboxylic acid (PubChem CID 143324447) has the molecular formula C19H21N7O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-[[5-[6-(ethylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy]pyridine-3-carboxylic acid.
| Compound Name | 2-[[5-[6-(ethylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 143324447 |
| Molecular Formula | C19H21N7O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-[[5-[6-(ethylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy]pyridine-3-carboxylic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1CCC(COc2ncccc2C(=O)O)O1 |
| InChI | InChI=1S/C19H21N7O5/c1-2-20-19(29)25-15-14-16(23-9-22-15)26(10-24-14)13-6-5-11(31-13)8-30-17-12(18(27)28)4-3-7-21-17/h3-4,7,9-11,13H,2,5-6,8H2,1H3,(H,27,28)(H2,20,22,23,25,29) |
| InChIKey | KNJXNOCQIVDYKB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 153.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |