C23H20ClFN4O2Se — CID 10697235
6-chloro-9-[(2R,3S,4R,5R)-4-fluoro-5-(phenylmethoxymethyl)-3-phenylselanyloxolan-2-yl]purine (PubChem CID 10697235) has the molecular formula C23H20ClFN4O2Se and a molecular weight of 517.85 g/mol. Its IUPAC name is 6-chloro-9-[(2R,3S,4R,5R)-4-fluoro-5-(phenylmethoxymethyl)-3-phenylselanyloxolan-2-yl]purine.
| Compound Name | 6-chloro-9-[(2R,3S,4R,5R)-4-fluoro-5-(phenylmethoxymethyl)-3-phenylselanyloxolan-2-yl]purine |
|---|---|
| PubChem CID | 10697235 |
| Molecular Formula | C23H20ClFN4O2Se |
| Molecular Weight | 517.85 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | 6-chloro-9-[(2R,3S,4R,5R)-4-fluoro-5-(phenylmethoxymethyl)-3-phenylselanyloxolan-2-yl]purine |
| SMILES | F[C@H]1[C@@H]([Se]c2ccccc2)[C@H](n2cnc3c(Cl)ncnc32)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C23H20ClFN4O2Se/c24-21-19-22(27-13-26-21)29(14-28-19)23-20(32-16-9-5-2-6-10-16)18(25)17(31-23)12-30-11-15-7-3-1-4-8-15/h1-10,13-14,17-18,20,23H,11-12H2/t17-,18-,20-,23-/m1/s1 |
| InChIKey | NUAJNSKDKOHRPQ-IVKZONNUSA-N |
| XLogP | 3.75 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.85 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|