C17H18N8O4 — CID 57239848
(2R,3R,4S,5R)-2-[6-(2-diazohydrazinyl)purin-9-yl]-5-(phenylmethoxymethyl)oxolane-3,4-diol (PubChem CID 57239848) has the molecular formula C17H18N8O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(2-diazohydrazinyl)purin-9-yl]-5-(phenylmethoxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(2-diazohydrazinyl)purin-9-yl]-5-(phenylmethoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57239848 |
| Molecular Formula | C17H18N8O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(2-diazohydrazinyl)purin-9-yl]-5-(phenylmethoxymethyl)oxolane-3,4-diol |
| SMILES | [N-]=[N+]=NNc1ncnc2c1ncn2[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H18N8O4/c18-23-24-22-15-12-16(20-8-19-15)25(9-21-12)17-14(27)13(26)11(29-17)7-28-6-10-4-2-1-3-5-10/h1-5,8-9,11,13-14,17,26-27H,6-7H2,(H,19,20,22)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | MARNSFAYYYGXAT-LSCFUAHRSA-N |
| XLogP | 1.30 |
| TPSA | 163.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|