C20H22N4O5 — CID 101076383
9-[(3aS,4S,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-6-phenylmethoxypurine (PubChem CID 101076383) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is 9-[(3aS,4S,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-6-phenylmethoxypurine.
| Compound Name | 9-[(3aS,4S,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-6-phenylmethoxypurine |
|---|---|
| PubChem CID | 101076383 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 9-[(3aS,4S,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-6-phenylmethoxypurine |
| SMILES | CO[C@H]1O[C@@H](n2cnc3c(OCc4ccccc4)ncnc32)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C20H22N4O5/c1-20(2)28-14-15(29-20)19(25-3)27-18(14)24-11-23-13-16(24)21-10-22-17(13)26-9-12-7-5-4-6-8-12/h4-8,10-11,14-15,18-19H,9H2,1-3H3/t14-,15+,18-,19+/m1/s1 |
| InChIKey | JJNLSXRZNLYUCJ-OHQAAIJDSA-N |
| XLogP | 2.43 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |