C14H18N4O4 — CID 102427604
9-[(3aR,4R,6R,6aR)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-methoxypurine (PubChem CID 102427604) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-methoxypurine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-methoxypurine |
|---|---|
| PubChem CID | 102427604 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-methoxypurine |
| SMILES | COc1ncnc2c1ncn2[C@@H]1O[C@H](C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C14H18N4O4/c1-7-9-10(22-14(2,3)21-9)13(20-7)18-6-17-8-11(18)15-5-16-12(8)19-4/h5-7,9-10,13H,1-4H3/t7-,9-,10-,13-/m1/s1 |
| InChIKey | GFOAFGVJOWCCLZ-QYVSTXNMSA-N |
| XLogP | 1.27 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |