C35H32N6O6 — CID 57043501
N-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[2-(phenylmethoxyamino)ethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-N-benzoylbenzamide (PubChem CID 57043501) has the molecular formula C35H32N6O6 and a molecular weight of 632.68 g/mol. Its IUPAC name is N-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[2-(phenylmethoxyamino)ethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-N-benzoylbenzamide.
| Compound Name | N-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[2-(phenylmethoxyamino)ethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-N-benzoylbenzamide |
|---|---|
| PubChem CID | 57043501 |
| Molecular Formula | C35H32N6O6 |
| Molecular Weight | 632.68 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | N-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[2-(phenylmethoxyamino)ethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-N-benzoylbenzamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C=CNOCc1ccccc1)O[C@H]2n1cnc2c(N(C(=O)c3ccccc3)C(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C35H32N6O6/c1-35(2)46-28-26(18-19-39-44-20-23-12-6-3-7-13-23)45-34(29(28)47-35)40-22-38-27-30(40)36-21-37-31(27)41(32(42)24-14-8-4-9-15-24)33(43)25-16-10-5-11-17-25/h3-19,21-22,26,28-29,34,39H,20H2,1-2H3/t26-,28-,29-,34-/m1/s1 |
| InChIKey | PJQVFMDOOBKFQE-ZLXUNRMYSA-N |
| XLogP | 4.97 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|