C26H31N5O4 — CID 91336619
9-[(3aS,4R,6R)-2,2-dimethyl-6-(2-phenylmethoxyethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine (PubChem CID 91336619) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is 9-[(3aS,4R,6R)-2,2-dimethyl-6-(2-phenylmethoxyethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine.
| Compound Name | 9-[(3aS,4R,6R)-2,2-dimethyl-6-(2-phenylmethoxyethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine |
|---|---|
| PubChem CID | 91336619 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 9-[(3aS,4R,6R)-2,2-dimethyl-6-(2-phenylmethoxyethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine |
| SMILES | CC1(C)OC2[C@@H](C=COCc3ccccc3)O[C@@H](n3cnc4c(NC5CCCC5)ncnc43)[C@H]2O1 |
| InChI | InChI=1S/C26H31N5O4/c1-26(2)34-21-19(12-13-32-14-17-8-4-3-5-9-17)33-25(22(21)35-26)31-16-29-20-23(27-15-28-24(20)31)30-18-10-6-7-11-18/h3-5,8-9,12-13,15-16,18-19,21-22,25H,6-7,10-11,14H2,1-2H3,(H,27,28,30)/t19-,21?,22+,25-/m1/s1 |
| InChIKey | QGVQSDUNOPMXCE-ZCUUHKFQSA-N |
| XLogP | 4.33 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|