C26H27F4N5O3 — CID 69469258
9-[(3aR,4R,6R,6aR)-6-[2-(2-fluorophenyl)ethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[3-(trifluoromethyl)cyclopentyl]purin-6-amine (PubChem CID 69469258) has the molecular formula C26H27F4N5O3 and a molecular weight of 533.53 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-6-[2-(2-fluorophenyl)ethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[3-(trifluoromethyl)cyclopentyl]purin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-6-[2-(2-fluorophenyl)ethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[3-(trifluoromethyl)cyclopentyl]purin-6-amine |
|---|---|
| PubChem CID | 69469258 |
| Molecular Formula | C26H27F4N5O3 |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-6-[2-(2-fluorophenyl)ethenyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-[3-(trifluoromethyl)cyclopentyl]purin-6-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C=Cc1ccccc1F)O[C@H]2n1cnc2c(NC3CCC(C(F)(F)F)C3)ncnc21 |
| InChI | InChI=1S/C26H27F4N5O3/c1-25(2)37-20-18(10-7-14-5-3-4-6-17(14)27)36-24(21(20)38-25)35-13-33-19-22(31-12-32-23(19)35)34-16-9-8-15(11-16)26(28,29)30/h3-7,10,12-13,15-16,18,20-21,24H,8-9,11H2,1-2H3,(H,31,32,34)/t15?,16?,18-,20-,21-,24-/m1/s1 |
| InChIKey | AVENFFIVRVSEOM-LWHLGMEQSA-N |
| XLogP | 5.24 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |