C23H27N7O3 — CID 69468288
1-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(2-pyrimidin-2-ylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]cyclopentan-1-amine (PubChem CID 69468288) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is 1-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(2-pyrimidin-2-ylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]cyclopentan-1-amine.
| Compound Name | 1-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(2-pyrimidin-2-ylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 69468288 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 1-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(2-pyrimidin-2-ylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]cyclopentan-1-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C=Cc1ncccn1)O[C@H]2n1cnc2c(C3(N)CCCC3)ncnc21 |
| InChI | InChI=1S/C23H27N7O3/c1-22(2)32-17-14(6-7-15-25-10-5-11-26-15)31-21(18(17)33-22)30-13-29-16-19(27-12-28-20(16)30)23(24)8-3-4-9-23/h5-7,10-14,17-18,21H,3-4,8-9,24H2,1-2H3/t14-,17-,18-,21-/m1/s1 |
| InChIKey | IBKBGJZDRDLPLU-HAXDFEGKSA-N |
| XLogP | 2.48 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |