C29H47N5O3Sn — CID 11678994
9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopropylpurin-6-amine (PubChem CID 11678994) has the molecular formula C29H47N5O3Sn and a molecular weight of 632.44 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopropylpurin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopropylpurin-6-amine |
|---|---|
| PubChem CID | 11678994 |
| Molecular Formula | C29H47N5O3Sn |
| Molecular Weight | 632.44 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopropylpurin-6-amine |
| SMILES | CCCC[Sn](/C=C/[C@H]1O[C@@H](n2cnc3c(NC4CC4)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21)(CCCC)CCCC |
| InChI | InChI=1S/C17H20N5O3.3C4H9.Sn/c1-4-10-12-13(25-17(2,3)24-12)16(23-10)22-8-20-11-14(21-9-5-6-9)18-7-19-15(11)22;3*1-3-4-2;/h1,4,7-10,12-13,16H,5-6H2,2-3H3,(H,18,19,21);3*1,3-4H2,2H3;/t10-,12-,13-,16-;;;;/m1..../s1 |
| InChIKey | PRYUDGDWMRYSEY-ORWCUUFYSA-N |
| XLogP | 6.76 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.44 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |