C17H23N5O3 — CID 173172283
9-[(4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine (PubChem CID 173172283) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 9-[(4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine.
| Compound Name | 9-[(4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine |
|---|---|
| PubChem CID | 173172283 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 9-[(4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine |
| SMILES | CC1(C)OC2[C@H](n3cnc4c(NC5CCCC5)ncnc43)OC[C@H]2O1 |
| InChI | InChI=1S/C17H23N5O3/c1-17(2)24-11-7-23-16(13(11)25-17)22-9-20-12-14(18-8-19-15(12)22)21-10-5-3-4-6-10/h8-11,13,16H,3-7H2,1-2H3,(H,18,19,21)/t11-,13?,16-/m1/s1 |
| InChIKey | MWDDENRAKRPYPN-UJBKNGIVSA-N |
| XLogP | 2.23 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |