C12H12Cl2N4O3 — CID 87510622
9-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,6-dichloropurine (PubChem CID 87510622) has the molecular formula C12H12Cl2N4O3 and a molecular weight of 331.16 g/mol. Its IUPAC name is 9-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,6-dichloropurine.
| Compound Name | 9-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,6-dichloropurine |
|---|---|
| PubChem CID | 87510622 |
| Molecular Formula | C12H12Cl2N4O3 |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 9-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,6-dichloropurine |
| SMILES | CC1(C)O[C@H]2[C@H](n3cnc4c(Cl)nc(Cl)nc43)OC[C@H]2O1 |
| InChI | InChI=1S/C12H12Cl2N4O3/c1-12(2)20-5-3-19-10(7(5)21-12)18-4-15-6-8(13)16-11(14)17-9(6)18/h4-5,7,10H,3H2,1-2H3/t5-,7-,10-/m1/s1 |
| InChIKey | XYBPONLRLWWLEJ-VISXPRAWSA-N |
| XLogP | 2.18 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |