C15H14Cl2N4O3 — CID 140665600
(1R,4S,5R,6S)-5-(2,6-dichloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carbaldehyde (PubChem CID 140665600) has the molecular formula C15H14Cl2N4O3 and a molecular weight of 369.21 g/mol. Its IUPAC name is (1R,4S,5R,6S)-5-(2,6-dichloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carbaldehyde.
| Compound Name | (1R,4S,5R,6S)-5-(2,6-dichloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carbaldehyde |
|---|---|
| PubChem CID | 140665600 |
| Molecular Formula | C15H14Cl2N4O3 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (1R,4S,5R,6S)-5-(2,6-dichloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carbaldehyde |
| SMILES | CC1(C)O[C@H]2[C@H](n3cnc4c(Cl)nc(Cl)nc43)[C@H]3CC3(C=O)[C@H]2O1 |
| InChI | InChI=1S/C15H14Cl2N4O3/c1-14(2)23-9-8(6-3-15(6,4-22)10(9)24-14)21-5-18-7-11(16)19-13(17)20-12(7)21/h4-6,8-10H,3H2,1-2H3/t6-,8-,9+,10+,15?/m1/s1 |
| InChIKey | HFBBQXMQVXBDQG-OCUZVOBXSA-N |
| XLogP | 2.41 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|