C15H18ClN5O3 — CID 71563129
[(1R,2R,4S,5R,6S)-5-(6-amino-2-chloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]-dideuteriomethanol (PubChem CID 71563129) has the molecular formula C15H18ClN5O3 and a molecular weight of 353.81 g/mol. Its IUPAC name is [(1R,2R,4S,5R,6S)-5-(6-amino-2-chloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]-dideuteriomethanol.
| Compound Name | [(1R,2R,4S,5R,6S)-5-(6-amino-2-chloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]-dideuteriomethanol |
|---|---|
| PubChem CID | 71563129 |
| Molecular Formula | C15H18ClN5O3 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [(1R,2R,4S,5R,6S)-5-(6-amino-2-chloropurin-9-yl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]-dideuteriomethanol |
| SMILES | [2H]C([2H])(O)[C@@]12C[C@@H]1[C@@H](n1cnc3c(N)nc(Cl)nc31)[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C15H18ClN5O3/c1-14(2)23-9-8(6-3-15(6,4-22)10(9)24-14)21-5-18-7-11(17)19-13(16)20-12(7)21/h5-6,8-10,22H,3-4H2,1-2H3,(H2,17,19,20)/t6-,8-,9+,10+,15+/m1/s1/i4D2 |
| InChIKey | JGPIEHIXFNKRCS-NLJRKKMNSA-N |
| XLogP | 1.14 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |