C19H25Cl2N4O5P — CID 45379362
2,6-dichloro-9-[(1R,2S,4S,5R,6S)-2-(diethoxyphosphorylmethyl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purine (PubChem CID 45379362) has the molecular formula C19H25Cl2N4O5P and a molecular weight of 491.31 g/mol. Its IUPAC name is 2,6-dichloro-9-[(1R,2S,4S,5R,6S)-2-(diethoxyphosphorylmethyl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purine.
| Compound Name | 2,6-dichloro-9-[(1R,2S,4S,5R,6S)-2-(diethoxyphosphorylmethyl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purine |
|---|---|
| PubChem CID | 45379362 |
| Molecular Formula | C19H25Cl2N4O5P |
| Molecular Weight | 491.31 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 2,6-dichloro-9-[(1R,2S,4S,5R,6S)-2-(diethoxyphosphorylmethyl)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purine |
| SMILES | CCOP(=O)(C[C@@]12C[C@@H]1[C@@H](n1cnc3c(Cl)nc(Cl)nc31)[C@@H]1OC(C)(C)O[C@@H]12)OCC |
| InChI | InChI=1S/C19H25Cl2N4O5P/c1-5-27-31(26,28-6-2)8-19-7-10(19)12(13-14(19)30-18(3,4)29-13)25-9-22-11-15(20)23-17(21)24-16(11)25/h9-10,12-14H,5-8H2,1-4H3/t10-,12-,13+,14+,19+/m1/s1 |
| InChIKey | FRQQXFOENHRMJH-SETQXRGISA-N |
| XLogP | 4.48 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|