C16H23ClN5O4PS2 — CID 88568703
(1R,2R,3S,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(diethoxyphosphinothioylsulfanylmethyl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 88568703) has the molecular formula C16H23ClN5O4PS2 and a molecular weight of 479.95 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(diethoxyphosphinothioylsulfanylmethyl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(diethoxyphosphinothioylsulfanylmethyl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 88568703 |
| Molecular Formula | C16H23ClN5O4PS2 |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(diethoxyphosphinothioylsulfanylmethyl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | CCOP(=S)(OCC)SC[C@]12C[C@@H]1[C@@H](n1cnc3c(N)nc(Cl)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C16H23ClN5O4PS2/c1-3-25-27(28,26-4-2)29-6-16-5-8(16)10(11(23)12(16)24)22-7-19-9-13(18)20-15(17)21-14(9)22/h7-8,10-12,23-24H,3-6H2,1-2H3,(H2,18,20,21)/t8-,10-,11+,12+,16-/m1/s1 |
| InChIKey | MDRPJOYUCMEPIR-RIWGCRELSA-N |
| XLogP | 2.38 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|