C16H20N7O5PS — CID 10939367
[(1R,2R,3S,4R,5S)-4-(6-amino-2-methylsulfanylpurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy-imidazol-1-ylphosphinic acid (PubChem CID 10939367) has the molecular formula C16H20N7O5PS and a molecular weight of 453.42 g/mol. Its IUPAC name is [(1R,2R,3S,4R,5S)-4-(6-amino-2-methylsulfanylpurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy-imidazol-1-ylphosphinic acid.
| Compound Name | [(1R,2R,3S,4R,5S)-4-(6-amino-2-methylsulfanylpurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy-imidazol-1-ylphosphinic acid |
|---|---|
| PubChem CID | 10939367 |
| Molecular Formula | C16H20N7O5PS |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | [(1R,2R,3S,4R,5S)-4-(6-amino-2-methylsulfanylpurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy-imidazol-1-ylphosphinic acid |
| SMILES | CSc1nc(N)c2ncn([C@H]3[C@H](O)[C@H](O)[C@]4(COP(=O)(O)n5ccnc5)C[C@H]34)c2n1 |
| InChI | InChI=1S/C16H20N7O5PS/c1-30-15-20-13(17)9-14(21-15)23(7-19-9)10-8-4-16(8,12(25)11(10)24)5-28-29(26,27)22-3-2-18-6-22/h2-3,6-8,10-12,24-25H,4-5H2,1H3,(H,26,27)(H2,17,20,21)/t8-,10-,11+,12+,16+/m1/s1 |
| InChIKey | NPXWXPKQCYWPCJ-MHDWVLHZSA-N |
| XLogP | 0.28 |
| TPSA | 174.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|