C17H26N5O4P — CID 149263677
(1S,2R,3S,4R,5S)-4-(6-amino-2-methylpurin-9-yl)-1-[2-[ethoxy(methyl)phosphoryl]ethyl]bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 149263677) has the molecular formula C17H26N5O4P and a molecular weight of 395.40 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-4-(6-amino-2-methylpurin-9-yl)-1-[2-[ethoxy(methyl)phosphoryl]ethyl]bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1S,2R,3S,4R,5S)-4-(6-amino-2-methylpurin-9-yl)-1-[2-[ethoxy(methyl)phosphoryl]ethyl]bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 149263677 |
| Molecular Formula | C17H26N5O4P |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (1S,2R,3S,4R,5S)-4-(6-amino-2-methylpurin-9-yl)-1-[2-[ethoxy(methyl)phosphoryl]ethyl]bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | CCOP(C)(=O)CC[C@@]12C[C@@H]1[C@@H](n1cnc3c(N)nc(C)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C17H26N5O4P/c1-4-26-27(3,25)6-5-17-7-10(17)12(13(23)14(17)24)22-8-19-11-15(18)20-9(2)21-16(11)22/h8,10,12-14,23-24H,4-7H2,1-3H3,(H2,18,20,21)/t10-,12-,13+,14+,17-,27?/m1/s1 |
| InChIKey | XPSPERXQJRJIKK-CHXDCWKKSA-N |
| XLogP | 1.33 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|