C12H14ClN5O3 — CID 170440050
(1R,2S,3R,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 170440050) has the molecular formula C12H14ClN5O3 and a molecular weight of 311.73 g/mol. Its IUPAC name is (1R,2S,3R,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2S,3R,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 170440050 |
| Molecular Formula | C12H14ClN5O3 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (1R,2S,3R,4R,5S)-4-(6-amino-2-chloropurin-9-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@H]1[C@@H](O)[C@@H](O)[C@]2(CO)C[C@H]12 |
| InChI | InChI=1S/C12H14ClN5O3/c13-11-16-9(14)5-10(17-11)18(3-15-5)6-4-1-12(4,2-19)8(21)7(6)20/h3-4,6-8,19-21H,1-2H2,(H2,14,16,17)/t4-,6-,7-,8-,12+/m1/s1 |
| InChIKey | ZPRWMVGQJGNLCO-IZHPCAQJSA-N |
| XLogP | -0.66 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |