C19H19ClIN5O3 — CID 10301919
(1R,2R,3S,4R,5S)-4-[2-chloro-6-[(2-iodophenyl)methylamino]purin-9-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 10301919) has the molecular formula C19H19ClIN5O3 and a molecular weight of 527.75 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-[2-chloro-6-[(2-iodophenyl)methylamino]purin-9-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-4-[2-chloro-6-[(2-iodophenyl)methylamino]purin-9-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 10301919 |
| Molecular Formula | C19H19ClIN5O3 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.02 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-[2-chloro-6-[(2-iodophenyl)methylamino]purin-9-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | OC[C@@]12C[C@@H]1[C@@H](n1cnc3c(NCc4ccccc4I)nc(Cl)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C19H19ClIN5O3/c20-18-24-16(22-6-9-3-1-2-4-11(9)21)12-17(25-18)26(8-23-12)13-10-5-19(10,7-27)15(29)14(13)28/h1-4,8,10,13-15,27-29H,5-7H2,(H,22,24,25)/t10-,13-,14+,15+,19+/m1/s1 |
| InChIKey | ANLQCXAZRWMPMZ-DRYZDSLUSA-N |
| XLogP | 1.97 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|