C21H22ClN5O2 — CID 88959674
(1R,2R,3S,4R,5S)-4-[2-chloro-6-[(2-cyclopropylphenyl)methylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 88959674) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-[2-chloro-6-[(2-cyclopropylphenyl)methylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-4-[2-chloro-6-[(2-cyclopropylphenyl)methylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 88959674 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-[2-chloro-6-[(2-cyclopropylphenyl)methylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H]2C[C@@H]2[C@H]1n1cnc2c(NCc3ccccc3C3CC3)nc(Cl)nc21 |
| InChI | InChI=1S/C21H22ClN5O2/c22-21-25-19(23-8-11-3-1-2-4-12(11)10-5-6-10)15-20(26-21)27(9-24-15)16-13-7-14(13)17(28)18(16)29/h1-4,9-10,13-14,16-18,28-29H,5-8H2,(H,23,25,26)/t13-,14+,16+,17+,18-/m0/s1 |
| InChIKey | XOAFEIAWIZBYKX-YKJOPOJSSA-N |
| XLogP | 2.88 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |