C26H29ClN6O3 — CID 166570772
N-[[[2-chloro-9-[(1S,2R,4S)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-6-yl]-(dicyclopropylmethyl)amino]methyl]benzamide (PubChem CID 166570772) has the molecular formula C26H29ClN6O3 and a molecular weight of 509.01 g/mol. Its IUPAC name is N-[[[2-chloro-9-[(1S,2R,4S)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-6-yl]-(dicyclopropylmethyl)amino]methyl]benzamide.
| Compound Name | N-[[[2-chloro-9-[(1S,2R,4S)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-6-yl]-(dicyclopropylmethyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 166570772 |
| Molecular Formula | C26H29ClN6O3 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | N-[[[2-chloro-9-[(1S,2R,4S)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-6-yl]-(dicyclopropylmethyl)amino]methyl]benzamide |
| SMILES | O=C(NCN(c1nc(Cl)nc2c1ncn2[C@H]1C(O)[C@@H](O)C2C[C@@H]21)C(C1CC1)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C26H29ClN6O3/c27-26-30-23(18-24(31-26)33(11-28-18)20-16-10-17(16)21(34)22(20)35)32(19(13-6-7-13)14-8-9-14)12-29-25(36)15-4-2-1-3-5-15/h1-5,11,13-14,16-17,19-22,34-35H,6-10,12H2,(H,29,36)/t16-,17?,20+,21-,22?/m0/s1 |
| InChIKey | ICNMZALRHRXRQC-RJPKHAGVSA-N |
| XLogP | 2.77 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|