C22H28ClN5O2 — CID 70676943
2-chloro-N-[(1R)-1,2-dicyclopropylethyl]-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-6-amine (PubChem CID 70676943) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-1,2-dicyclopropylethyl]-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-6-amine.
| Compound Name | 2-chloro-N-[(1R)-1,2-dicyclopropylethyl]-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-6-amine |
|---|---|
| PubChem CID | 70676943 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-chloro-N-[(1R)-1,2-dicyclopropylethyl]-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-6-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H]3C[C@@H]3[C@@H](n3cnc4c(N[C@H](CC5CC5)C5CC5)nc(Cl)nc43)[C@@H]2O1 |
| InChI | InChI=1S/C22H28ClN5O2/c1-22(2)29-17-13-8-12(13)16(18(17)30-22)28-9-24-15-19(26-21(23)27-20(15)28)25-14(11-5-6-11)7-10-3-4-10/h9-14,16-18H,3-8H2,1-2H3,(H,25,26,27)/t12-,13+,14+,16+,17+,18-/m0/s1 |
| InChIKey | FXTRIRSNQWIROE-NRNHGZALSA-N |
| XLogP | 4.18 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |