C20H26ClN5O2 — CID 70676777
2-chloro-N-[(1S)-1-cyclopropylpropyl]-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-6-amine (PubChem CID 70676777) has the molecular formula C20H26ClN5O2 and a molecular weight of 403.91 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-1-cyclopropylpropyl]-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-6-amine.
| Compound Name | 2-chloro-N-[(1S)-1-cyclopropylpropyl]-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-6-amine |
|---|---|
| PubChem CID | 70676777 |
| Molecular Formula | C20H26ClN5O2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-chloro-N-[(1S)-1-cyclopropylpropyl]-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]purin-6-amine |
| SMILES | CC[C@H](Nc1nc(Cl)nc2c1ncn2[C@@H]1[C@H]2C[C@H]2[C@H]2OC(C)(C)O[C@H]21)C1CC1 |
| InChI | InChI=1S/C20H26ClN5O2/c1-4-12(9-5-6-9)23-17-13-18(25-19(21)24-17)26(8-22-13)14-10-7-11(10)15-16(14)28-20(2,3)27-15/h8-12,14-16H,4-7H2,1-3H3,(H,23,24,25)/t10-,11+,12-,14+,15+,16-/m0/s1 |
| InChIKey | SRFLJTONCBAHCL-RJUOPTFYSA-N |
| XLogP | 3.79 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |