C16H19ClFN5O2 — CID 162735379
2-chloro-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-N-(2-fluoroethyl)purin-6-amine (PubChem CID 162735379) has the molecular formula C16H19ClFN5O2 and a molecular weight of 367.81 g/mol. Its IUPAC name is 2-chloro-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-N-(2-fluoroethyl)purin-6-amine.
| Compound Name | 2-chloro-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-N-(2-fluoroethyl)purin-6-amine |
|---|---|
| PubChem CID | 162735379 |
| Molecular Formula | C16H19ClFN5O2 |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-chloro-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-N-(2-fluoroethyl)purin-6-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H]3C[C@@H]3[C@@H](n3cnc4c(NCCF)nc(Cl)nc43)[C@@H]2O1 |
| InChI | InChI=1S/C16H19ClFN5O2/c1-16(2)24-11-8-5-7(8)10(12(11)25-16)23-6-20-9-13(19-4-3-18)21-15(17)22-14(9)23/h6-8,10-12H,3-5H2,1-2H3,(H,19,21,22)/t7-,8+,10+,11+,12-/m0/s1 |
| InChIKey | QLVKWPVQMDVSEH-FFVUVFKMSA-N |
| XLogP | 2.57 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |