C14H14ClIN4O2 — CID 44596478
6-chloro-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-2-iodopurine (PubChem CID 44596478) has the molecular formula C14H14ClIN4O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is 6-chloro-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-2-iodopurine.
| Compound Name | 6-chloro-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-2-iodopurine |
|---|---|
| PubChem CID | 44596478 |
| Molecular Formula | C14H14ClIN4O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 6-chloro-9-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]-2-iodopurine |
| SMILES | CC1(C)O[C@@H]2[C@@H]3C[C@@H]3[C@@H](n3cnc4c(Cl)nc(I)nc43)[C@@H]2O1 |
| InChI | InChI=1S/C14H14ClIN4O2/c1-14(2)21-9-6-3-5(6)8(10(9)22-14)20-4-17-7-11(15)18-13(16)19-12(7)20/h4-6,8-10H,3H2,1-2H3/t5-,6+,8+,9+,10-/m0/s1 |
| InChIKey | GBAUTLZCVIMNEI-LUTUWXHWSA-N |
| XLogP | 2.80 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|