C24H25ClFN5O4 — CID 11202868
ethyl (1R,2S,4S,5R,6S)-5-[2-chloro-6-[(3-fluorophenyl)methylamino]purin-9-yl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate (PubChem CID 11202868) has the molecular formula C24H25ClFN5O4 and a molecular weight of 501.95 g/mol. Its IUPAC name is ethyl (1R,2S,4S,5R,6S)-5-[2-chloro-6-[(3-fluorophenyl)methylamino]purin-9-yl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate.
| Compound Name | ethyl (1R,2S,4S,5R,6S)-5-[2-chloro-6-[(3-fluorophenyl)methylamino]purin-9-yl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate |
|---|---|
| PubChem CID | 11202868 |
| Molecular Formula | C24H25ClFN5O4 |
| Molecular Weight | 501.95 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | ethyl (1R,2S,4S,5R,6S)-5-[2-chloro-6-[(3-fluorophenyl)methylamino]purin-9-yl]-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-2-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@@H]1[C@@H](n1cnc3c(NCc4cccc(F)c4)nc(Cl)nc31)[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C24H25ClFN5O4/c1-4-33-21(32)24-9-14(24)16(17-18(24)35-23(2,3)34-17)31-11-28-15-19(29-22(25)30-20(15)31)27-10-12-6-5-7-13(26)8-12/h5-8,11,14,16-18H,4,9-10H2,1-3H3,(H,27,29,30)/t14-,16-,17+,18+,24+/m1/s1 |
| InChIKey | LZHZLGYHXBOINK-WMNHRYSVSA-N |
| XLogP | 3.88 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.95 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |