C17H18ClN5O3 — CID 146365012
(4S)-2-[2-chloro-6-[(3-methylphenyl)methylamino]purin-9-yl]oxolane-3,4-diol (PubChem CID 146365012) has the molecular formula C17H18ClN5O3 and a molecular weight of 375.82 g/mol. Its IUPAC name is (4S)-2-[2-chloro-6-[(3-methylphenyl)methylamino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (4S)-2-[2-chloro-6-[(3-methylphenyl)methylamino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 146365012 |
| Molecular Formula | C17H18ClN5O3 |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (4S)-2-[2-chloro-6-[(3-methylphenyl)methylamino]purin-9-yl]oxolane-3,4-diol |
| SMILES | Cc1cccc(CNc2nc(Cl)nc3c2ncn3C2OC[C@H](O)C2O)c1 |
| InChI | InChI=1S/C17H18ClN5O3/c1-9-3-2-4-10(5-9)6-19-14-12-15(22-17(18)21-14)23(8-20-12)16-13(25)11(24)7-26-16/h2-5,8,11,13,16,24-25H,6-7H2,1H3,(H,19,21,22)/t11-,13?,16?/m0/s1 |
| InChIKey | KMNMKUCIWVCOJO-XOMBGVMMSA-N |
| XLogP | 1.65 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |