C20H21ClIN5O4 — CID 10896988
(2R,3R,4S,5R)-2-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(cyclopropyloxymethyl)oxolane-3,4-diol (PubChem CID 10896988) has the molecular formula C20H21ClIN5O4 and a molecular weight of 557.78 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(cyclopropyloxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(cyclopropyloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10896988 |
| Molecular Formula | C20H21ClIN5O4 |
| Molecular Weight | 557.78 g/mol |
| Exact Mass | 557.03 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-5-(cyclopropyloxymethyl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](COC2CC2)O[C@H]1n1cnc2c(NCc3cccc(I)c3)nc(Cl)nc21 |
| InChI | InChI=1S/C20H21ClIN5O4/c21-20-25-17(23-7-10-2-1-3-11(22)6-10)14-18(26-20)27(9-24-14)19-16(29)15(28)13(31-19)8-30-12-4-5-12/h1-3,6,9,12-13,15-16,19,28-29H,4-5,7-8H2,(H,23,25,26)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | CPZMUYPOIXKZIA-NVQRDWNXSA-N |
| XLogP | 2.49 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|