C18H19ClIN7O5 — CID 90800194
[(2R,3S,4S,5R)-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]urea (PubChem CID 90800194) has the molecular formula C18H19ClIN7O5 and a molecular weight of 575.75 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]urea.
| Compound Name | [(2R,3S,4S,5R)-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]urea |
|---|---|
| PubChem CID | 90800194 |
| Molecular Formula | C18H19ClIN7O5 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.02 |
| IUPAC Name | [(2R,3S,4S,5R)-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]urea |
| SMILES | NC(=O)N[C@@]1(O)[C@@H](CO)O[C@@H](n2cnc3c(NCc4cccc(I)c4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C18H19ClIN7O5/c19-16-24-13(22-5-8-2-1-3-9(20)4-8)11-14(25-16)27(7-23-11)15-12(29)18(31,26-17(21)30)10(6-28)32-15/h1-4,7,10,12,15,28-29,31H,5-6H2,(H3,21,26,30)(H,22,24,25)/t10-,12+,15-,18-/m1/s1 |
| InChIKey | QBABRGWQPTZHDG-YFRNRWJPSA-N |
| XLogP | 0.30 |
| TPSA | 180.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|