C31H24ClFIN5O5 — CID 101334767
[(2R,3R,4S,5R)-4-benzoyloxy-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3-fluorooxolan-2-yl]methyl benzoate (PubChem CID 101334767) has the molecular formula C31H24ClFIN5O5 and a molecular weight of 727.92 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-benzoyloxy-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3-fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R)-4-benzoyloxy-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3-fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101334767 |
| Molecular Formula | C31H24ClFIN5O5 |
| Molecular Weight | 727.92 g/mol |
| Exact Mass | 727.05 |
| IUPAC Name | [(2R,3R,4S,5R)-4-benzoyloxy-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-3-fluorooxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2cnc3c(NCc4cccc(I)c4)nc(Cl)nc32)[C@H](OC(=O)c2ccccc2)[C@@H]1F)c1ccccc1 |
| InChI | InChI=1S/C31H24ClFIN5O5/c32-31-37-26(35-15-18-8-7-13-21(34)14-18)24-27(38-31)39(17-36-24)28-25(44-30(41)20-11-5-2-6-12-20)23(33)22(43-28)16-42-29(40)19-9-3-1-4-10-19/h1-14,17,22-23,25,28H,15-16H2,(H,35,37,38)/t22-,23-,25-,28-/m1/s1 |
| InChIKey | LUVWZZBDJUUSON-QMHRWYJISA-N |
| XLogP | 6.01 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.92 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|